C20H22F3N3O2S — CID 25015088
2-[5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide (PubChem CID 25015088) has the molecular formula C20H22F3N3O2S and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-[5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 25015088 |
| Molecular Formula | C20H22F3N3O2S |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[5-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-2,3-dihydro-1H-inden-2-yl]-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1C1Cc2ccc(-n3nc(C(F)(F)F)c4c3CCCC4)cc2C1 |
| InChI | InChI=1S/C20H22F3N3O2S/c21-20(22,23)19-17-4-1-2-5-18(17)26(24-19)15-7-6-13-10-16(12-14(13)11-15)25-8-3-9-29(25,27)28/h6-7,11,16H,1-5,8-10,12H2 |
| InChIKey | HIYBKJVBBLLWMG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |