C20H24O5 — CID 25015150
(4R,6S,9R,13S,14E,17R)-6,15-dimethyl-10-methylidene-5,12,18-trioxatetracyclo[15.2.1.04,6.09,13]icosa-1(20),14-diene-11,19-dione (PubChem CID 25015150) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (4R,6S,9R,13S,14E,17R)-6,15-dimethyl-10-methylidene-5,12,18-trioxatetracyclo[15.2.1.04,6.09,13]icosa-1(20),14-diene-11,19-dione.
| Compound Name | (4R,6S,9R,13S,14E,17R)-6,15-dimethyl-10-methylidene-5,12,18-trioxatetracyclo[15.2.1.04,6.09,13]icosa-1(20),14-diene-11,19-dione |
|---|---|
| PubChem CID | 25015150 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (4R,6S,9R,13S,14E,17R)-6,15-dimethyl-10-methylidene-5,12,18-trioxatetracyclo[15.2.1.04,6.09,13]icosa-1(20),14-diene-11,19-dione |
| SMILES | C=C1C(=O)O[C@H]2/C=C(\C)C[C@@H]3C=C(CC[C@H]4O[C@@]4(C)CC[C@H]12)C(=O)O3 |
| InChI | InChI=1S/C20H24O5/c1-11-8-14-10-13(19(22)23-14)4-5-17-20(3,25-17)7-6-15-12(2)18(21)24-16(15)9-11/h9-10,14-17H,2,4-8H2,1,3H3/b11-9+/t14-,15-,16+,17-,20+/m1/s1 |
| InChIKey | GKZBZZYALRNEFE-IWCRVHLMSA-N |
| XLogP | 3.00 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|