C16H14N2OS — CID 2501567
(2R)-N-(2-cyanophenyl)-2-phenylsulfanylpropanamide (PubChem CID 2501567) has the molecular formula C16H14N2OS and a molecular weight of 282.37 g/mol. Its IUPAC name is (2R)-N-(2-cyanophenyl)-2-phenylsulfanylpropanamide.
| Compound Name | (2R)-N-(2-cyanophenyl)-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 2501567 |
| Molecular Formula | C16H14N2OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (2R)-N-(2-cyanophenyl)-2-phenylsulfanylpropanamide |
| SMILES | C[C@@H](Sc1ccccc1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C16H14N2OS/c1-12(20-14-8-3-2-4-9-14)16(19)18-15-10-6-5-7-13(15)11-17/h2-10,12H,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | OQYHGQZABAQUQI-GFCCVEGCSA-N |
| XLogP | 3.68 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |