C23H25Cl2N5O3 — CID 25015773
1-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide (PubChem CID 25015773) has the molecular formula C23H25Cl2N5O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is 1-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 25015773 |
| Molecular Formula | C23H25Cl2N5O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 1-[5-[2-(3,5-dichloro-4-pyridinyl)acetyl]-8-methoxy-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-N-(2,2-dimethylpropyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C(=O)Cc2c(Cl)cncc2Cl)n2nc(C3(C(=O)NCC(C)(C)C)CC3)nc12 |
| InChI | InChI=1S/C23H25Cl2N5O3/c1-22(2,3)12-27-21(32)23(7-8-23)20-28-19-18(33-4)6-5-16(30(19)29-20)17(31)9-13-14(24)10-26-11-15(13)25/h5-6,10-11H,7-9,12H2,1-4H3,(H,27,32) |
| InChIKey | PIEWYNAWBZBZHR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |