C19H34O3 — CID 25015886
(5E,9E,13R)-13-hydroxy-14-methoxy-6,10,14-trimethylpentadeca-5,9-dien-2-one (PubChem CID 25015886) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (5E,9E,13R)-13-hydroxy-14-methoxy-6,10,14-trimethylpentadeca-5,9-dien-2-one.
| Compound Name | (5E,9E,13R)-13-hydroxy-14-methoxy-6,10,14-trimethylpentadeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 25015886 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (5E,9E,13R)-13-hydroxy-14-methoxy-6,10,14-trimethylpentadeca-5,9-dien-2-one |
| SMILES | COC(C)(C)[C@H](O)CC/C(C)=C/CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C19H34O3/c1-15(11-8-12-17(3)20)9-7-10-16(2)13-14-18(21)19(4,5)22-6/h10-11,18,21H,7-9,12-14H2,1-6H3/b15-11+,16-10+/t18-/m1/s1 |
| InChIKey | HMWOJWOBZVLXGN-CCPODNGTSA-N |
| XLogP | 4.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|