C22H32O3 — CID 25016151
[(2S)-2-[(1S,4R,4aS)-4-methyl-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl]-6-methyl-4-oxohept-5-en-3-yl] acetate (PubChem CID 25016151) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(2S)-2-[(1S,4R,4aS)-4-methyl-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl]-6-methyl-4-oxohept-5-en-3-yl] acetate.
| Compound Name | [(2S)-2-[(1S,4R,4aS)-4-methyl-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl]-6-methyl-4-oxohept-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 25016151 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(2S)-2-[(1S,4R,4aS)-4-methyl-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalen-1-yl]-6-methyl-4-oxohept-5-en-3-yl] acetate |
| SMILES | C=C1C=C2[C@@H](CC1)[C@H](C)CC[C@H]2[C@H](C)C(OC(C)=O)C(=O)C=C(C)C |
| InChI | InChI=1S/C22H32O3/c1-13(2)11-21(24)22(25-17(6)23)16(5)19-10-8-15(4)18-9-7-14(3)12-20(18)19/h11-12,15-16,18-19,22H,3,7-10H2,1-2,4-6H3/t15-,16+,18+,19+,22?/m1/s1 |
| InChIKey | ALKQOCXLHHKOJQ-CPDLSWESSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|