About 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine
2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine (PubChem CID 25016610) has the molecular formula C17H17N7
and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine |
| PubChem CID | 25016610 |
| Molecular Formula | C17H17N7 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine |
| SMILES | Cc1cc(C)n(-c2nc(Nc3ccccc3)c3ncn(C)c3n2)n1 |
| InChI | InChI=1S/C17H17N7/c1-11-9-12(2)24(22-11)17-20-15(19-13-7-5-4-6-8-13)14-16(21-17)23(3)10-18-14/h4-10H,1-3H3,(H,19,20,21) |
| InChIKey | SWQBZPXHGALVPL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine?
The IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine (CID 25016610) is 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine.
What is the SMILES notation for 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine?
The canonical SMILES for 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine is Cc1cc(C)n(-c2nc(Nc3ccccc3)c3ncn(C)c3n2)n1.
What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine?
The InChIKey is SWQBZPXHGALVPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N7/c1-11-9-12(2)24(22-11)17-20-15(19-13-7-5-4-6-8-13)14-16(21-17)23(3)10-18-14/h4-10H,1-3H3,(H,19,20,21).
What are the key properties of 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine?
2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine has a molecular weight of 319.37 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpyrazol-1-yl)-9-methyl-N-phenylpurin-6-amine is sourced from PubChem (CID 25016610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).