About spiro[3,4-dihydrochromene-2,2'-oxane]
spiro[3,4-dihydrochromene-2,2'-oxane] (PubChem CID 25016653) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is spiro[3,4-dihydrochromene-2,2'-oxane].
Molecular Properties
| Compound Name | spiro[3,4-dihydrochromene-2,2'-oxane] |
| PubChem CID | 25016653 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | spiro[3,4-dihydrochromene-2,2'-oxane] |
| SMILES | c1ccc2c(c1)CCC1(CCCCO1)O2 |
| InChI | InChI=1S/C13H16O2/c1-2-6-12-11(5-1)7-9-13(15-12)8-3-4-10-14-13/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | DPKPFXDFUUWBNV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3,4-dihydrochromene-2,2'-oxane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3,4-dihydrochromene-2,2'-oxane]?
The IUPAC name of spiro[3,4-dihydrochromene-2,2'-oxane] (CID 25016653) is spiro[3,4-dihydrochromene-2,2'-oxane].
What is the SMILES notation for spiro[3,4-dihydrochromene-2,2'-oxane]?
The canonical SMILES for spiro[3,4-dihydrochromene-2,2'-oxane] is c1ccc2c(c1)CCC1(CCCCO1)O2.
What is the InChIKey of spiro[3,4-dihydrochromene-2,2'-oxane]?
The InChIKey is DPKPFXDFUUWBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-6-12-11(5-1)7-9-13(15-12)8-3-4-10-14-13/h1-2,5-6H,3-4,7-10H2.
What are the key properties of spiro[3,4-dihydrochromene-2,2'-oxane]?
spiro[3,4-dihydrochromene-2,2'-oxane] has a molecular weight of 204.27 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3,4-dihydrochromene-2,2'-oxane] is sourced from PubChem (CID 25016653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).