About 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione
9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione (PubChem CID 25016975) has the molecular formula C17H10FNO3
and a molecular weight of 295.27 g/mol. Its IUPAC name is 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione.
Molecular Properties
| Compound Name | 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione |
| PubChem CID | 25016975 |
| Molecular Formula | C17H10FNO3 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione |
| SMILES | Cc1cc(=O)[nH]c2ccc3c4cc(F)ccc4oc(=O)c3c12 |
| InChI | InChI=1S/C17H10FNO3/c1-8-6-14(20)19-12-4-3-10-11-7-9(18)2-5-13(11)22-17(21)16(10)15(8)12/h2-7H,1H3,(H,19,20) |
| InChIKey | MZILYDLMSDTOPA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione?
The IUPAC name of 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione (CID 25016975) is 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione.
What is the SMILES notation for 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione?
The canonical SMILES for 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione is Cc1cc(=O)[nH]c2ccc3c4cc(F)ccc4oc(=O)c3c12.
What is the InChIKey of 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione?
The InChIKey is MZILYDLMSDTOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10FNO3/c1-8-6-14(20)19-12-4-3-10-11-7-9(18)2-5-13(11)22-17(21)16(10)15(8)12/h2-7H,1H3,(H,19,20).
What are the key properties of 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione?
9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione has a molecular weight of 295.27 g/mol, XLogP of 3.24, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-4-methyl-1H-chromeno[3,4-f]quinoline-2,5-dione is sourced from PubChem (CID 25016975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).