C20H26ClNO2 — CID 25017086
ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride (PubChem CID 25017086) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride.
| Compound Name | ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride |
|---|---|
| PubChem CID | 25017086 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | ethyl (2R,4S)-4-amino-2-methyl-5-(4-phenylphenyl)pentanoate;hydrochloride |
| SMILES | CCOC(=O)[C@H](C)C[C@H](N)Cc1ccc(-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H25NO2.ClH/c1-3-23-20(22)15(2)13-19(21)14-16-9-11-18(12-10-16)17-7-5-4-6-8-17;/h4-12,15,19H,3,13-14,21H2,1-2H3;1H/t15-,19+;/m1./s1 |
| InChIKey | MYJTZLYRAWUSLB-WSCVZUBPSA-N |
| XLogP | 4.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |