C20H19NO4 — CID 25017240
5,10-dimethoxy-4,5-dimethyl-1H-chromeno[3,4-f]quinolin-2-one (PubChem CID 25017240) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 5,10-dimethoxy-4,5-dimethyl-1H-chromeno[3,4-f]quinolin-2-one.
| Compound Name | 5,10-dimethoxy-4,5-dimethyl-1H-chromeno[3,4-f]quinolin-2-one |
|---|---|
| PubChem CID | 25017240 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5,10-dimethoxy-4,5-dimethyl-1H-chromeno[3,4-f]quinolin-2-one |
| SMILES | COc1cccc2c1-c1ccc3[nH]c(=O)cc(C)c3c1C(C)(OC)O2 |
| InChI | InChI=1S/C20H19NO4/c1-11-10-16(22)21-13-9-8-12-18-14(23-3)6-5-7-15(18)25-20(2,24-4)19(12)17(11)13/h5-10H,1-4H3,(H,21,22) |
| InChIKey | ATWBVUJXKYZKHP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |