About (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione
(3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione (PubChem CID 25017461) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione.
Molecular Properties
| Compound Name | (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione |
| PubChem CID | 25017461 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione |
| SMILES | CC(C)/C=c1\c(=O)[nH]/c(=C/c2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C16H18N2O2/c1-11(2)9-14-15(19)17-13(16(20)18(14)3)10-12-7-5-4-6-8-12/h4-11H,1-3H3,(H,17,19)/b13-10+,14-9+ |
| InChIKey | CTZGZVHXTTYHAK-JUCMHCFKSA-N |
| XLogP | 0.34 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione?
The IUPAC name of (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione (CID 25017461) is (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione.
What is the SMILES notation for (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione?
The canonical SMILES for (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione is CC(C)/C=c1\c(=O)[nH]/c(=C/c2ccccc2)c(=O)n1C.
What is the InChIKey of (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione?
The InChIKey is CTZGZVHXTTYHAK-JUCMHCFKSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-11(2)9-14-15(19)17-13(16(20)18(14)3)10-12-7-5-4-6-8-12/h4-11H,1-3H3,(H,17,19)/b13-10+,14-9+.
What are the key properties of (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione?
(3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione has a molecular weight of 270.33 g/mol, XLogP of 0.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,6E)-3-benzylidene-1-methyl-6-(2-methylpropylidene)piperazine-2,5-dione is sourced from PubChem (CID 25017461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).