About 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione
10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione (PubChem CID 25017766) has the molecular formula C18H10F3NO4
and a molecular weight of 361.28 g/mol. Its IUPAC name is 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione.
Molecular Properties
| Compound Name | 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione |
| PubChem CID | 25017766 |
| Molecular Formula | C18H10F3NO4 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione |
| SMILES | COc1cccc2c(=O)oc3c(ccc4[nH]c(=O)cc(C(F)(F)F)c43)c12 |
| InChI | InChI=1S/C18H10F3NO4/c1-25-12-4-2-3-9-14(12)8-5-6-11-15(16(8)26-17(9)24)10(18(19,20)21)7-13(23)22-11/h2-7H,1H3,(H,22,23) |
| InChIKey | CQEVMEWKXDDUBJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione?
The IUPAC name of 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione (CID 25017766) is 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione.
What is the SMILES notation for 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione?
The canonical SMILES for 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione is COc1cccc2c(=O)oc3c(ccc4[nH]c(=O)cc(C(F)(F)F)c43)c12.
What is the InChIKey of 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione?
The InChIKey is CQEVMEWKXDDUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F3NO4/c1-25-12-4-2-3-9-14(12)8-5-6-11-15(16(8)26-17(9)24)10(18(19,20)21)7-13(23)22-11/h2-7H,1H3,(H,22,23).
What are the key properties of 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione?
10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione has a molecular weight of 361.28 g/mol, XLogP of 3.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-4-(trifluoromethyl)-1H-isochromeno[3,4-f]quinoline-2,6-dione is sourced from PubChem (CID 25017766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).