C24H38O5 — CID 25018209
(2R)-2-[(3R,6R)-6-[2-[(4aS,8aS)-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid (PubChem CID 25018209) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is (2R)-2-[(3R,6R)-6-[2-[(4aS,8aS)-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid.
| Compound Name | (2R)-2-[(3R,6R)-6-[2-[(4aS,8aS)-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 25018209 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | (2R)-2-[(3R,6R)-6-[2-[(4aS,8aS)-2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl]ethyl]-6-methyldioxan-3-yl]propanoic acid |
| SMILES | CC1=C(CC[C@]2(C)CC[C@H]([C@@H](C)C(=O)O)OO2)[C@@]2(C)CCCC(C)(C)[C@@H]2CC1=O |
| InChI | InChI=1S/C24H38O5/c1-15-17(24(6)11-7-10-22(3,4)20(24)14-18(15)25)8-12-23(5)13-9-19(28-29-23)16(2)21(26)27/h16,19-20H,7-14H2,1-6H3,(H,26,27)/t16-,19-,20+,23-,24-/m1/s1 |
| InChIKey | LMYASVRPTJJACG-BMDKEWNISA-N |
| XLogP | 5.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|