C24H44O2 — CID 25018211
(E)-7,11-dimethyl-13-(2,6,6-trimethylcyclohexen-1-yl)tridec-10-ene-4,7-diol (PubChem CID 25018211) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is (E)-7,11-dimethyl-13-(2,6,6-trimethylcyclohexen-1-yl)tridec-10-ene-4,7-diol.
| Compound Name | (E)-7,11-dimethyl-13-(2,6,6-trimethylcyclohexen-1-yl)tridec-10-ene-4,7-diol |
|---|---|
| PubChem CID | 25018211 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | (E)-7,11-dimethyl-13-(2,6,6-trimethylcyclohexen-1-yl)tridec-10-ene-4,7-diol |
| SMILES | CCCC(O)CCC(C)(O)CC/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H44O2/c1-7-10-21(25)15-18-24(6,26)17-8-11-19(2)13-14-22-20(3)12-9-16-23(22,4)5/h11,21,25-26H,7-10,12-18H2,1-6H3/b19-11+ |
| InChIKey | QFNAZHJHBGQQAF-YBFXNURJSA-N |
| XLogP | 6.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|