C24H12Cl2N4O6S — CID 25018217
1,3-bis[(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 25018217) has the molecular formula C24H12Cl2N4O6S and a molecular weight of 555.36 g/mol. Its IUPAC name is 1,3-bis[(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-bis[(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 25018217 |
| Molecular Formula | C24H12Cl2N4O6S |
| Molecular Weight | 555.36 g/mol |
| Exact Mass | 553.99 |
| IUPAC Name | 1,3-bis[(E)-(6-chloro-4-oxochromen-3-yl)methylideneamino]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1CC(=O)N(/N=C/c2coc3ccc(Cl)cc3c2=O)C(=S)N1/N=C/c1coc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C24H12Cl2N4O6S/c25-14-1-3-18-16(5-14)22(33)12(10-35-18)8-27-29-20(31)7-21(32)30(24(29)37)28-9-13-11-36-19-4-2-15(26)6-17(19)23(13)34/h1-6,8-11H,7H2/b27-8+,28-9+ |
| InChIKey | IADPDSNAWASAEV-MUXXHTTHSA-N |
| XLogP | 3.92 |
| TPSA | 125.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|