C24H24N2O2 — CID 25018775
1-[2-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]-7-methyl-3-phenylquinolin-4-one (PubChem CID 25018775) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[2-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]-7-methyl-3-phenylquinolin-4-one.
| Compound Name | 1-[2-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]-7-methyl-3-phenylquinolin-4-one |
|---|---|
| PubChem CID | 25018775 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[2-(2,5-dimethyl-2,5-dihydropyrrol-1-yl)-2-oxoethyl]-7-methyl-3-phenylquinolin-4-one |
| SMILES | Cc1ccc2c(=O)c(-c3ccccc3)cn(CC(=O)N3C(C)C=CC3C)c2c1 |
| InChI | InChI=1S/C24H24N2O2/c1-16-9-12-20-22(13-16)25(15-23(27)26-17(2)10-11-18(26)3)14-21(24(20)28)19-7-5-4-6-8-19/h4-14,17-18H,15H2,1-3H3 |
| InChIKey | CZEXJJNXGJUPOG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|