C23H25FN2O4S — CID 25018930
ethyl 4-[2-(benzenesulfonyl)-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]butanoate (PubChem CID 25018930) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is ethyl 4-[2-(benzenesulfonyl)-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]butanoate.
| Compound Name | ethyl 4-[2-(benzenesulfonyl)-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]butanoate |
|---|---|
| PubChem CID | 25018930 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | ethyl 4-[2-(benzenesulfonyl)-8-fluoro-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]butanoate |
| SMILES | CCOC(=O)CCCn1c2c(c3cc(F)ccc31)CN(S(=O)(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C23H25FN2O4S/c1-2-30-23(27)9-6-13-26-21-11-10-17(24)15-19(21)20-16-25(14-12-22(20)26)31(28,29)18-7-4-3-5-8-18/h3-5,7-8,10-11,15H,2,6,9,12-14,16H2,1H3 |
| InChIKey | FMGYCBAFHRFCAY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|