C15H22O4 — CID 25018968
2-hydroxy-4-[2-[(1S,4S,6R)-4-hydroxy-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one (PubChem CID 25018968) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-hydroxy-4-[2-[(1S,4S,6R)-4-hydroxy-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 2-hydroxy-4-[2-[(1S,4S,6R)-4-hydroxy-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 25018968 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-hydroxy-4-[2-[(1S,4S,6R)-4-hydroxy-1,2,6-trimethylcyclohex-2-en-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CC1=C[C@@H](O)C[C@@H](C)[C@]1(C)CCC1=CC(O)OC1=O |
| InChI | InChI=1S/C15H22O4/c1-9-6-12(16)7-10(2)15(9,3)5-4-11-8-13(17)19-14(11)18/h6,8,10,12-13,16-17H,4-5,7H2,1-3H3/t10-,12-,13?,15-/m1/s1 |
| InChIKey | ZATJKUHWCNECPY-SMOZSMSJSA-N |
| XLogP | 1.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|