C15H20O3 — CID 25018970
(1'S,3aS,5'R,7R,7aR)-3a,7,7a-trimethylspiro[1,2,6,7-tetrahydroindene-3,4'-2,6-dioxabicyclo[3.1.0]hexane]-3'-one (PubChem CID 25018970) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1'S,3aS,5'R,7R,7aR)-3a,7,7a-trimethylspiro[1,2,6,7-tetrahydroindene-3,4'-2,6-dioxabicyclo[3.1.0]hexane]-3'-one.
| Compound Name | (1'S,3aS,5'R,7R,7aR)-3a,7,7a-trimethylspiro[1,2,6,7-tetrahydroindene-3,4'-2,6-dioxabicyclo[3.1.0]hexane]-3'-one |
|---|---|
| PubChem CID | 25018970 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1'S,3aS,5'R,7R,7aR)-3a,7,7a-trimethylspiro[1,2,6,7-tetrahydroindene-3,4'-2,6-dioxabicyclo[3.1.0]hexane]-3'-one |
| SMILES | C[C@@H]1CC=C[C@]2(C)C3(CC[C@]12C)C(=O)O[C@@H]1O[C@@H]13 |
| InChI | InChI=1S/C15H20O3/c1-9-5-4-6-14(3)13(9,2)7-8-15(14)10-11(17-10)18-12(15)16/h4,6,9-11H,5,7-8H2,1-3H3/t9-,10+,11+,13-,14+,15?/m1/s1 |
| InChIKey | HJDDZDXAKURJLF-CODNQQLUSA-N |
| XLogP | 2.66 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|