C21H26O4 — CID 25019249
methyl 3-[(1aS,3R,4R,8aS)-8-ethenyl-4,7-dimethyl-6-oxo-3-prop-1-en-2-yl-2,3-dihydro-1aH-naphtho[4,4a-b]oxiren-4-yl]propanoate (PubChem CID 25019249) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl 3-[(1aS,3R,4R,8aS)-8-ethenyl-4,7-dimethyl-6-oxo-3-prop-1-en-2-yl-2,3-dihydro-1aH-naphtho[4,4a-b]oxiren-4-yl]propanoate.
| Compound Name | methyl 3-[(1aS,3R,4R,8aS)-8-ethenyl-4,7-dimethyl-6-oxo-3-prop-1-en-2-yl-2,3-dihydro-1aH-naphtho[4,4a-b]oxiren-4-yl]propanoate |
|---|---|
| PubChem CID | 25019249 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | methyl 3-[(1aS,3R,4R,8aS)-8-ethenyl-4,7-dimethyl-6-oxo-3-prop-1-en-2-yl-2,3-dihydro-1aH-naphtho[4,4a-b]oxiren-4-yl]propanoate |
| SMILES | C=CC1=C(C)C(=O)C=C2[C@]13O[C@H]3C[C@H](C(=C)C)[C@@]2(C)CCC(=O)OC |
| InChI | InChI=1S/C21H26O4/c1-7-14-13(4)16(22)11-17-20(5,9-8-19(23)24-6)15(12(2)3)10-18-21(14,17)25-18/h7,11,15,18H,1-2,8-10H2,3-6H3/t15-,18+,20-,21-/m1/s1 |
| InChIKey | OLVDZXLYEJAWNY-NSGGIEJNSA-N |
| XLogP | 3.69 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|