C27H32F2N3O7PS — CID 25019316
2-[2,2-difluoroethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphate (PubChem CID 25019316) has the molecular formula C27H32F2N3O7PS and a molecular weight of 611.60 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[2,2-difluoroethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 25019316 |
| Molecular Formula | C27H32F2N3O7PS |
| Molecular Weight | 611.60 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | 2-[2,2-difluoroethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]ethyl dihydrogen phosphate |
| SMILES | CCS(=O)(=O)c1cccc(-c2ccc(OCCCN(CCOP(=O)(O)O)CC(F)F)c3[nH]c4ncc(C)cc4c23)c1 |
| InChI | InChI=1S/C27H32F2N3O7PS/c1-3-41(36,37)20-7-4-6-19(15-20)21-8-9-23(26-25(21)22-14-18(2)16-30-27(22)31-26)38-12-5-10-32(17-24(28)29)11-13-39-40(33,34)35/h4,6-9,14-16,24H,3,5,10-13,17H2,1-2H3,(H,30,31)(H2,33,34,35) |
| InChIKey | XVANEMXSZHELBE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|