C28H32F2N3O7PS — CID 25019317
2-[3-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2-difluoroethyl)amino]ethyl dihydrogen phosphate (PubChem CID 25019317) has the molecular formula C28H32F2N3O7PS and a molecular weight of 623.62 g/mol. Its IUPAC name is 2-[3-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2-difluoroethyl)amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[3-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2-difluoroethyl)amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 25019317 |
| Molecular Formula | C28H32F2N3O7PS |
| Molecular Weight | 623.62 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | 2-[3-[[5-(3-cyclopropylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2-difluoroethyl)amino]ethyl dihydrogen phosphate |
| SMILES | Cc1cnc2[nH]c3c(OCCCN(CCOP(=O)(O)O)CC(F)F)ccc(-c4cccc(S(=O)(=O)C5CC5)c4)c3c2c1 |
| InChI | InChI=1S/C28H32F2N3O7PS/c1-18-14-23-26-22(19-4-2-5-21(15-19)42(37,38)20-6-7-20)8-9-24(27(26)32-28(23)31-16-18)39-12-3-10-33(17-25(29)30)11-13-40-41(34,35)36/h2,4-5,8-9,14-16,20,25H,3,6-7,10-13,17H2,1H3,(H,31,32)(H2,34,35,36) |
| InChIKey | ZRZCAKKXCSDWFL-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|