C24H29NO — CID 25019321
(1R,10R)-11-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene (PubChem CID 25019321) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is (1R,10R)-11-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene.
| Compound Name | (1R,10R)-11-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene |
|---|---|
| PubChem CID | 25019321 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (1R,10R)-11-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene |
| SMILES | COc1ccc2c(c1)C(CN1C[C@@H]3CC[C@@H]1Cc1ccccc1C3)CC2 |
| InChI | InChI=1S/C24H29NO/c1-26-23-11-9-18-7-8-21(24(18)14-23)16-25-15-17-6-10-22(25)13-20-5-3-2-4-19(20)12-17/h2-5,9,11,14,17,21-22H,6-8,10,12-13,15-16H2,1H3/t17-,21?,22-/m1/s1 |
| InChIKey | RIWOHVOWWDPTFV-PNWAUMQTSA-N |
| XLogP | 4.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |