C17H19F2NO3 — CID 25019391
2,2-difluoro-6-phenoxy-1-pyridin-2-ylhexane-1,1-diol (PubChem CID 25019391) has the molecular formula C17H19F2NO3 and a molecular weight of 323.34 g/mol. Its IUPAC name is 2,2-difluoro-6-phenoxy-1-pyridin-2-ylhexane-1,1-diol.
| Compound Name | 2,2-difluoro-6-phenoxy-1-pyridin-2-ylhexane-1,1-diol |
|---|---|
| PubChem CID | 25019391 |
| Molecular Formula | C17H19F2NO3 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2,2-difluoro-6-phenoxy-1-pyridin-2-ylhexane-1,1-diol |
| SMILES | OC(O)(c1ccccn1)C(F)(F)CCCCOc1ccccc1 |
| InChI | InChI=1S/C17H19F2NO3/c18-16(19,17(21,22)15-10-4-6-12-20-15)11-5-7-13-23-14-8-2-1-3-9-14/h1-4,6,8-10,12,21-22H,5,7,11,13H2 |
| InChIKey | ZBXTXASEVIWZPR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|