About Jsm-10292
Jsm-10292 (PubChem CID 25019714) has the molecular formula C28H24F3N5O2
and a molecular weight of 519.50 g/mol. Its IUPAC name is 1-[[4-methyl-3-[[2-methyl-4-(4-methyl-1H-pyrazol-5-yl)quinolin-8-yl]oxymethyl]-2-pyridinyl]methyl]-3-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | Jsm-10292 |
| PubChem CID | 25019714 |
| Molecular Formula | C28H24F3N5O2 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 1-[[4-methyl-3-[[2-methyl-4-(4-methyl-1H-pyrazol-5-yl)quinolin-8-yl]oxymethyl]-2-pyridinyl]methyl]-3-(trifluoromethyl)pyridin-2-one |
| SMILES | CC1=C(C(=NC=C1)CN2C=CC=C(C2=O)C(F)(F)F)COC3=CC=CC4=C(C=C(N=C43)C)C5=C(C=NN5)C |
| InChI | InChI=1S/C28H24F3N5O2/c1-16-9-10-32-23(14-36-11-5-7-22(27(36)37)28(29,30)31)21(16)15-38-24-8-4-6-19-20(12-18(3)34-26(19)24)25-17(2)13-33-35-25/h4-13H,14-15H2,1-3H3,(H,33,35) |
| InChIKey | KFVOKCIYVVCZGF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | 911 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze Jsm-10292 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Jsm-10292?
The IUPAC name of Jsm-10292 (CID 25019714) is 1-[[4-methyl-3-[[2-methyl-4-(4-methyl-1H-pyrazol-5-yl)quinolin-8-yl]oxymethyl]-2-pyridinyl]methyl]-3-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for Jsm-10292?
The canonical SMILES for Jsm-10292 is CC1=C(C(=NC=C1)CN2C=CC=C(C2=O)C(F)(F)F)COC3=CC=CC4=C(C=C(N=C43)C)C5=C(C=NN5)C.
What is the InChIKey of Jsm-10292?
The InChIKey is KFVOKCIYVVCZGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24F3N5O2/c1-16-9-10-32-23(14-36-11-5-7-22(27(36)37)28(29,30)31)21(16)15-38-24-8-4-6-19-20(12-18(3)34-26(19)24)25-17(2)13-33-35-25/h4-13H,14-15H2,1-3H3,(H,33,35).
What are the key properties of Jsm-10292?
Jsm-10292 has a molecular weight of 519.50 g/mol, XLogP of 4.60, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for Jsm-10292 is sourced from PubChem (CID 25019714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).