C27H28ClF3N3O7PS — CID 25019830
2-[3-[[3-chloro-5-(3-cyclopropylsulfonylphenyl)-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate (PubChem CID 25019830) has the molecular formula C27H28ClF3N3O7PS and a molecular weight of 662.02 g/mol. Its IUPAC name is 2-[3-[[3-chloro-5-(3-cyclopropylsulfonylphenyl)-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[3-[[3-chloro-5-(3-cyclopropylsulfonylphenyl)-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 25019830 |
| Molecular Formula | C27H28ClF3N3O7PS |
| Molecular Weight | 662.02 g/mol |
| Exact Mass | 661.10 |
| IUPAC Name | 2-[3-[[3-chloro-5-(3-cyclopropylsulfonylphenyl)-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OCCN(CCCOc1ccc(-c2cccc(S(=O)(=O)C3CC3)c2)c2c1[nH]c1ncc(Cl)cc12)CC(F)(F)F |
| InChI | InChI=1S/C27H28ClF3N3O7PS/c28-18-14-22-24-21(17-3-1-4-20(13-17)43(38,39)19-5-6-19)7-8-23(25(24)33-26(22)32-15-18)40-11-2-9-34(16-27(29,30)31)10-12-41-42(35,36)37/h1,3-4,7-8,13-15,19H,2,5-6,9-12,16H2,(H,32,33)(H2,35,36,37) |
| InChIKey | XHZYVHCZUIWKKE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.02 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|