C27H32F2N3O7PS — CID 25019831
[2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]-2,2-difluoroethyl] dihydrogen phosphate (PubChem CID 25019831) has the molecular formula C27H32F2N3O7PS and a molecular weight of 611.60 g/mol. Its IUPAC name is [2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]-2,2-difluoroethyl] dihydrogen phosphate.
| Compound Name | [2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]-2,2-difluoroethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 25019831 |
| Molecular Formula | C27H32F2N3O7PS |
| Molecular Weight | 611.60 g/mol |
| Exact Mass | 611.17 |
| IUPAC Name | [2-[ethyl-[3-[[5-(3-ethylsulfonylphenyl)-3-methyl-9H-pyrido[2,3-b]indol-8-yl]oxy]propyl]amino]-2,2-difluoroethyl] dihydrogen phosphate |
| SMILES | CCN(CCCOc1ccc(-c2cccc(S(=O)(=O)CC)c2)c2c1[nH]c1ncc(C)cc12)C(F)(F)COP(=O)(O)O |
| InChI | InChI=1S/C27H32F2N3O7PS/c1-4-32(27(28,29)17-39-40(33,34)35)12-7-13-38-23-11-10-21(19-8-6-9-20(15-19)41(36,37)5-2)24-22-14-18(3)16-30-26(22)31-25(23)24/h6,8-11,14-16H,4-5,7,12-13,17H2,1-3H3,(H,30,31)(H2,33,34,35) |
| InChIKey | BRSUWJORSHNAGP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|