C26H25NO8 — CID 25020067
[(E)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 25020067) has the molecular formula C26H25NO8 and a molecular weight of 479.49 g/mol. Its IUPAC name is [(E)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [(E)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 25020067 |
| Molecular Formula | C26H25NO8 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | [(E)-(2,2-dimethyl-8-oxo-4H-pyrano[3,2-g]chromen-3-ylidene)amino] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O/N=C2\Cc3cc4ccc(=O)oc4cc3OC2(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C26H25NO8/c1-26(2)22(13-17-12-16-7-9-23(28)33-18(16)14-19(17)34-26)27-35-24(29)8-6-15-10-20(30-3)25(32-5)21(11-15)31-4/h6-12,14H,13H2,1-5H3/b8-6+,27-22+ |
| InChIKey | GMCBQOVRSIUTLM-UYVPSTCYSA-N |
| XLogP | 4.14 |
| TPSA | 105.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|