C26H31FN2O6 — CID 25020081
methyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[3-[fluoro-(methoxyamino)methyl]-4-methoxy-5-methylphenyl]hex-5-enoate (PubChem CID 25020081) has the molecular formula C26H31FN2O6 and a molecular weight of 486.54 g/mol. Its IUPAC name is methyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[3-[fluoro-(methoxyamino)methyl]-4-methoxy-5-methylphenyl]hex-5-enoate.
| Compound Name | methyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[3-[fluoro-(methoxyamino)methyl]-4-methoxy-5-methylphenyl]hex-5-enoate |
|---|---|
| PubChem CID | 25020081 |
| Molecular Formula | C26H31FN2O6 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | methyl (E)-6-(3,7-dimethyl-2-oxo-1,3-benzoxazol-5-yl)-6-[3-[fluoro-(methoxyamino)methyl]-4-methoxy-5-methylphenyl]hex-5-enoate |
| SMILES | CONC(F)c1cc(/C(=C\CCCC(=O)OC)c2cc(C)c3oc(=O)n(C)c3c2)cc(C)c1OC |
| InChI | InChI=1S/C26H31FN2O6/c1-15-11-17(13-20(23(15)33-5)25(27)28-34-6)19(9-7-8-10-22(30)32-4)18-12-16(2)24-21(14-18)29(3)26(31)35-24/h9,11-14,25,28H,7-8,10H2,1-6H3/b19-9+ |
| InChIKey | LIWCRDQERDNMFJ-DJKKODMXSA-N |
| XLogP | 4.65 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|