C21H20ClN5O — CID 25020360
8-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 25020360) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is 8-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 25020360 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 8-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1NCCC12CCN(c1nc(-c3ccnc(Cl)c3)cc3cnccc13)CC2 |
| InChI | InChI=1S/C21H20ClN5O/c22-18-12-14(1-7-24-18)17-11-15-13-23-6-2-16(15)19(26-17)27-9-4-21(5-10-27)3-8-25-20(21)28/h1-2,6-7,11-13H,3-5,8-10H2,(H,25,28) |
| InChIKey | UBADRKNXRIRBSR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|