C21H19ClF3N5O — CID 25020418
1-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 25020418) has the molecular formula C21H19ClF3N5O and a molecular weight of 449.86 g/mol. Its IUPAC name is 1-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25020418 |
| Molecular Formula | C21H19ClF3N5O |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[3-(2-chloro-4-pyridinyl)-2,6-naphthyridin-1-yl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCN(c2nc(-c3ccnc(Cl)c3)cc3cnccc23)CC1 |
| InChI | InChI=1S/C21H19ClF3N5O/c22-18-10-14(1-6-27-18)17-9-15-11-26-5-2-16(15)19(29-17)30-7-3-13(4-8-30)20(31)28-12-21(23,24)25/h1-2,5-6,9-11,13H,3-4,7-8,12H2,(H,28,31) |
| InChIKey | CIVDTDNFYILSPK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|