C10H16O4 — CID 25020818
(3aR,4S,5R,6aS)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 25020818) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 25020818 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3aR,4S,5R,6aS)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | COC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC |
| InChI | InChI=1S/C10H16O4/c1-12-5-7-6-3-10(11)14-9(6)4-8(7)13-2/h6-9H,3-5H2,1-2H3/t6-,7-,8-,9+/m1/s1 |
| InChIKey | ZPFGKIXVBDWICQ-BGZDPUMWSA-N |
| XLogP | 0.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |