C9H13FO3 — CID 25020820
(3aR,4R,5R,6aS)-4-(fluoromethyl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 25020820) has the molecular formula C9H13FO3 and a molecular weight of 188.20 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(fluoromethyl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-(fluoromethyl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 25020820 |
| Molecular Formula | C9H13FO3 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(fluoromethyl)-5-methoxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CO[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1CF |
| InChI | InChI=1S/C9H13FO3/c1-12-7-3-8-5(6(7)4-10)2-9(11)13-8/h5-8H,2-4H2,1H3/t5-,6-,7-,8+/m1/s1 |
| InChIKey | HSDDVPFQNIJDHD-XUTVFYLZSA-N |
| XLogP | 0.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |