C17H22N4O2S — CID 25020869
3-butyl-6-(3,4-diethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 25020869) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is 3-butyl-6-(3,4-diethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-butyl-6-(3,4-diethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 25020869 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-butyl-6-(3,4-diethoxyphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CCCCc1nnc2sc(-c3ccc(OCC)c(OCC)c3)nn12 |
| InChI | InChI=1S/C17H22N4O2S/c1-4-7-8-15-18-19-17-21(15)20-16(24-17)12-9-10-13(22-5-2)14(11-12)23-6-3/h9-11H,4-8H2,1-3H3 |
| InChIKey | MZPWKXMVJLLLSX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |