C21H37N7O3 — CID 25021162
tert-butyl N-[6-[[2-(2-hydroxyethylamino)-9-propan-2-ylpurin-6-yl]amino]hexyl]carbamate (PubChem CID 25021162) has the molecular formula C21H37N7O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl N-[6-[[2-(2-hydroxyethylamino)-9-propan-2-ylpurin-6-yl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[2-(2-hydroxyethylamino)-9-propan-2-ylpurin-6-yl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 25021162 |
| Molecular Formula | C21H37N7O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | tert-butyl N-[6-[[2-(2-hydroxyethylamino)-9-propan-2-ylpurin-6-yl]amino]hexyl]carbamate |
| SMILES | CC(C)n1cnc2c(NCCCCCCNC(=O)OC(C)(C)C)nc(NCCO)nc21 |
| InChI | InChI=1S/C21H37N7O3/c1-15(2)28-14-25-16-17(26-19(23-12-13-29)27-18(16)28)22-10-8-6-7-9-11-24-20(30)31-21(3,4)5/h14-15,29H,6-13H2,1-5H3,(H,24,30)(H2,22,23,26,27) |
| InChIKey | OXQIKGQQLYDQBM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|