About CID 25021416
CID 25021416 (PubChem CID 25021416) has the molecular formula C12H7AsClO
and a molecular weight of 277.56 g/mol.
Molecular Properties
| Compound Name | CID 25021416 |
| PubChem CID | 25021416 |
| Molecular Formula | C12H7AsClO |
| Molecular Weight | 277.56 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | — |
| SMILES | Clc1cccc2c1[As]c1ccccc1O2 |
| InChI | InChI=1S/C12H7AsClO/c14-9-5-3-7-11-12(9)13-8-4-1-2-6-10(8)15-11/h1-7H |
| InChIKey | UHGNARJEJDKEBE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 25021416 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 25021416?
The IUPAC name of CID 25021416 (CID 25021416) is not available.
What is the SMILES notation for CID 25021416?
The canonical SMILES for CID 25021416 is Clc1cccc2c1[As]c1ccccc1O2.
What is the InChIKey of CID 25021416?
The InChIKey is UHGNARJEJDKEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7AsClO/c14-9-5-3-7-11-12(9)13-8-4-1-2-6-10(8)15-11/h1-7H.
What are the key properties of CID 25021416?
CID 25021416 has a molecular weight of 277.56 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 25021416 is sourced from PubChem (CID 25021416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).