C14H15NO5 — CID 25022391
(4aR,7aS)-4-benzoyl-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one (PubChem CID 25022391) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (4aR,7aS)-4-benzoyl-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one.
| Compound Name | (4aR,7aS)-4-benzoyl-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one |
|---|---|
| PubChem CID | 25022391 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (4aR,7aS)-4-benzoyl-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one |
| SMILES | COC1CN(C(=O)c2ccccc2)[C@H]2C(=O)OC[C@H]2O1 |
| InChI | InChI=1S/C14H15NO5/c1-18-11-7-15(12-10(20-11)8-19-14(12)17)13(16)9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3/t10-,11?,12-/m1/s1 |
| InChIKey | BAHWLXPUHALFEA-IGBJHFKCSA-N |
| XLogP | 0.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |