C14H28O4S — CID 25022417
(2R,3S,4S,5S)-2-methoxy-5-(octylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 25022417) has the molecular formula C14H28O4S and a molecular weight of 292.44 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-methoxy-5-(octylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-2-methoxy-5-(octylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 25022417 |
| Molecular Formula | C14H28O4S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (2R,3S,4S,5S)-2-methoxy-5-(octylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | CCCCCCCCSC[C@H]1O[C@@H](OC)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H28O4S/c1-3-4-5-6-7-8-9-19-10-11-12(15)13(16)14(17-2)18-11/h11-16H,3-10H2,1-2H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | GUVPWBJUUSVHNN-YIYPIFLZSA-N |
| XLogP | 2.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|