C21H22N3O3+ — CID 25022428
N'-(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)ethane-1,2-diamine (PubChem CID 25022428) has the molecular formula C21H22N3O3+ and a molecular weight of 364.43 g/mol. Its IUPAC name is N'-(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)ethane-1,2-diamine.
| Compound Name | N'-(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 25022428 |
| Molecular Formula | C21H22N3O3+ |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N'-(17-methoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaen-16-yl)ethane-1,2-diamine |
| SMILES | COc1ccc2cc3[n+](cc2c1NCCN)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C21H21N3O3/c1-25-18-3-2-13-8-17-15-10-20-19(26-12-27-20)9-14(15)4-7-24(17)11-16(13)21(18)23-6-5-22/h2-3,8-11H,4-7,12,22H2,1H3/p+1 |
| InChIKey | VVBLDXKHXFFHTP-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|