C20H17F6N3O4 — CID 25022795
methyl (2E)-2-[2-[[(Z)-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate (PubChem CID 25022795) has the molecular formula C20H17F6N3O4 and a molecular weight of 477.36 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[(Z)-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[(Z)-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 25022795 |
| Molecular Formula | C20H17F6N3O4 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | methyl (2E)-2-[2-[[(Z)-[amino-[3,5-bis(trifluoromethyl)phenyl]methylidene]amino]oxymethyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1CO/N=C(\N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F6N3O4/c1-31-18(30)16(28-32-2)15-6-4-3-5-11(15)10-33-29-17(27)12-7-13(19(21,22)23)9-14(8-12)20(24,25)26/h3-9H,10H2,1-2H3,(H2,27,29)/b28-16+ |
| InChIKey | FSUDVJCZALEDMW-LQKURTRISA-N |
| XLogP | 4.08 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|