C21H40O2Si — CID 25022876
(5R,6R,9S,10R)-3,6-dimethyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]decan-4-one (PubChem CID 25022876) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (5R,6R,9S,10R)-3,6-dimethyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]decan-4-one.
| Compound Name | (5R,6R,9S,10R)-3,6-dimethyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 25022876 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (5R,6R,9S,10R)-3,6-dimethyl-9-propan-2-yl-10-triethylsilyloxyspiro[4.5]decan-4-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](C(C)C)CC[C@@H](C)[C@]12CCC(C)C2=O |
| InChI | InChI=1S/C21H40O2Si/c1-8-24(9-2,10-3)23-20-18(15(4)5)12-11-17(7)21(20)14-13-16(6)19(21)22/h15-18,20H,8-14H2,1-7H3/t16?,17-,18+,20-,21+/m1/s1 |
| InChIKey | VGXMDUFEDKBSPE-XOGABFJHSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|