C11H14ClIO4 — CID 25022879
[(3aR,4R,5S,7aS)-7-chloro-4-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate (PubChem CID 25022879) has the molecular formula C11H14ClIO4 and a molecular weight of 372.59 g/mol. Its IUPAC name is [(3aR,4R,5S,7aS)-7-chloro-4-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate.
| Compound Name | [(3aR,4R,5S,7aS)-7-chloro-4-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate |
|---|---|
| PubChem CID | 25022879 |
| Molecular Formula | C11H14ClIO4 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | [(3aR,4R,5S,7aS)-7-chloro-4-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(Cl)[C@H]2OC(C)(C)O[C@H]2[C@@H]1I |
| InChI | InChI=1S/C11H14ClIO4/c1-5(14)15-7-4-6(12)9-10(8(7)13)17-11(2,3)16-9/h4,7-10H,1-3H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | DJHHKVKSELAUAZ-JLIMGVALSA-N |
| XLogP | 2.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|