About [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate
[(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate (PubChem CID 25023173) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate |
| PubChem CID | 25023173 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate |
| SMILES | C=CC[C@@H](OC=C)C(C)(C)COC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H24O3/c1-5-9-19(23-6-2)21(3,4)15-24-20(22)18-13-12-16-10-7-8-11-17(16)14-18/h5-8,10-14,19H,1-2,9,15H2,3-4H3/t19-/m1/s1 |
| InChIKey | BEQSHUUMRBHMMH-LJQANCHMSA-N |
| XLogP | 5.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate?
The IUPAC name of [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate (CID 25023173) is [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate.
What is the SMILES notation for [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate?
The canonical SMILES for [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate is C=CC[C@@H](OC=C)C(C)(C)COC(=O)c1ccc2ccccc2c1.
What is the InChIKey of [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate?
The InChIKey is BEQSHUUMRBHMMH-LJQANCHMSA-N. The full InChI is InChI=1S/C21H24O3/c1-5-9-19(23-6-2)21(3,4)15-24-20(22)18-13-12-16-10-7-8-11-17(16)14-18/h5-8,10-14,19H,1-2,9,15H2,3-4H3/t19-/m1/s1.
What are the key properties of [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate?
[(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate has a molecular weight of 324.42 g/mol, XLogP of 5.13, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-ethenoxy-2,2-dimethylhex-5-enyl] naphthalene-2-carboxylate is sourced from PubChem (CID 25023173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).