C9H14O — CID 25023282
(3aS,7aR)-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran (PubChem CID 25023282) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3aS,7aR)-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran.
| Compound Name | (3aS,7aR)-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 25023282 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3aS,7aR)-7a-methyl-3,3a,4,7-tetrahydro-2H-1-benzofuran |
| SMILES | C[C@@]12CC=CC[C@H]1CCO2 |
| InChI | InChI=1S/C9H14O/c1-9-6-3-2-4-8(9)5-7-10-9/h2-3,8H,4-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | OCRCSNIEMSEUCS-DTWKUNHWSA-N |
| XLogP | 2.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|