C19H25N3O4S — CID 25023527
(E,6R)-12-azido-9-(benzenesulfonyl)-6-methyldodec-3-ene-2,8-dione (PubChem CID 25023527) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is (E,6R)-12-azido-9-(benzenesulfonyl)-6-methyldodec-3-ene-2,8-dione.
| Compound Name | (E,6R)-12-azido-9-(benzenesulfonyl)-6-methyldodec-3-ene-2,8-dione |
|---|---|
| PubChem CID | 25023527 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (E,6R)-12-azido-9-(benzenesulfonyl)-6-methyldodec-3-ene-2,8-dione |
| SMILES | CC(=O)/C=C/C[C@@H](C)CC(=O)C(CCCN=[N+]=[N-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-15(8-6-9-16(2)23)14-18(24)19(12-7-13-21-22-20)27(25,26)17-10-4-3-5-11-17/h3-6,9-11,15,19H,7-8,12-14H2,1-2H3/b9-6+/t15-,19?/m1/s1 |
| InChIKey | YBXIKHNPACAMBH-JWGYUIJTSA-N |
| XLogP | 4.05 |
| TPSA | 117.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|