C28H23N7O7 — CID 25023553
N-[(1S)-1-[4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-2-methylpropyl]-2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide (PubChem CID 25023553) has the molecular formula C28H23N7O7 and a molecular weight of 569.53 g/mol. Its IUPAC name is N-[(1S)-1-[4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-2-methylpropyl]-2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1S)-1-[4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-2-methylpropyl]-2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 25023553 |
| Molecular Formula | C28H23N7O7 |
| Molecular Weight | 569.53 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N-[(1S)-1-[4-[4-(4-ethenyl-1,3-oxazol-2-yl)-1,3-oxazol-2-yl]-1,3-oxazol-2-yl]-2-methylpropyl]-2-[2-(2-prop-2-enyl-1,3-oxazol-4-yl)-1,3-oxazol-4-yl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CCc1nc(-c2nc(-c3nc(C(=O)N[C@H](c4nc(-c5nc(-c6nc(C=C)co6)co5)co4)C(C)C)co3)co2)co1 |
| InChI | InChI=1S/C28H23N7O7/c1-5-7-21-30-17(10-37-21)25-33-19(12-40-25)26-31-16(9-39-26)23(36)35-22(14(3)4)28-34-20(13-42-28)27-32-18(11-41-27)24-29-15(6-2)8-38-24/h5-6,8-14,22H,1-2,7H2,3-4H3,(H,35,36)/t22-/m0/s1 |
| InChIKey | NKJDVKMMMTVEHN-QFIPXVFZSA-N |
| XLogP | 5.78 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|