C15H19NO7 — CID 25023582
(2R,4aR,6S,7R,8R,8aS)-6-ethoxy-7-nitro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 25023582) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aS)-6-ethoxy-7-nitro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (2R,4aR,6S,7R,8R,8aS)-6-ethoxy-7-nitro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 25023582 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aS)-6-ethoxy-7-nitro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CCO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19NO7/c1-2-20-15-11(16(18)19)12(17)13-10(22-15)8-21-14(23-13)9-6-4-3-5-7-9/h3-7,10-15,17H,2,8H2,1H3/t10-,11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | NNIJSXPPZPKHFP-OJVARPOJSA-N |
| XLogP | 0.87 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|