C18H34O5Si — CID 25023656
(2S,3R,4R,4aS,7S,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-8-triethylsilyloxy-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-6-one (PubChem CID 25023656) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is (2S,3R,4R,4aS,7S,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-8-triethylsilyloxy-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-6-one.
| Compound Name | (2S,3R,4R,4aS,7S,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-8-triethylsilyloxy-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-6-one |
|---|---|
| PubChem CID | 25023656 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (2S,3R,4R,4aS,7S,8S,8aS)-3-hydroxy-2,4,7,8a-tetramethyl-8-triethylsilyloxy-2,3,4,4a,7,8-hexahydropyrano[3,2-b]pyran-6-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H](C)C(=O)O[C@H]2[C@H](C)[C@@H](O)[C@H](C)O[C@@]21C |
| InChI | InChI=1S/C18H34O5Si/c1-8-24(9-2,10-3)23-16-12(5)17(20)21-15-11(4)14(19)13(6)22-18(15,16)7/h11-16,19H,8-10H2,1-7H3/t11-,12+,13+,14-,15+,16+,18+/m1/s1 |
| InChIKey | IMJYEHNLSYQLRO-CRJFESBUSA-N |
| XLogP | 3.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|