C24H34N2O4+2 — CID 25023712
(2S)-2-[4-[4-[(2S)-2-hydroxy-4,4-dimethylmorpholin-4-ium-2-yl]phenyl]phenyl]-4,4-dimethylmorpholin-4-ium-2-ol (PubChem CID 25023712) has the molecular formula C24H34N2O4+2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (2S)-2-[4-[4-[(2S)-2-hydroxy-4,4-dimethylmorpholin-4-ium-2-yl]phenyl]phenyl]-4,4-dimethylmorpholin-4-ium-2-ol.
| Compound Name | (2S)-2-[4-[4-[(2S)-2-hydroxy-4,4-dimethylmorpholin-4-ium-2-yl]phenyl]phenyl]-4,4-dimethylmorpholin-4-ium-2-ol |
|---|---|
| PubChem CID | 25023712 |
| Molecular Formula | C24H34N2O4+2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (2S)-2-[4-[4-[(2S)-2-hydroxy-4,4-dimethylmorpholin-4-ium-2-yl]phenyl]phenyl]-4,4-dimethylmorpholin-4-ium-2-ol |
| SMILES | C[N+]1(C)CCO[C@@](O)(c2ccc(-c3ccc([C@@]4(O)C[N+](C)(C)CCO4)cc3)cc2)C1 |
| InChI | InChI=1S/C24H34N2O4/c1-25(2)13-15-29-23(27,17-25)21-9-5-19(6-10-21)20-7-11-22(12-8-20)24(28)18-26(3,4)14-16-30-24/h5-12,27-28H,13-18H2,1-4H3/q+2/t23-,24-/m1/s1 |
| InChIKey | JIWUESGGKYLPPG-DNQXCXABSA-N |
| XLogP | 1.86 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|